About oxo-bis(2,2,2-trifluoroethoxy)phosphanium
oxo-bis(2,2,2-trifluoroethoxy)phosphanium (PubChem CID 6386648) has the molecular formula C4H4F6O3P+
and a molecular weight of 245.03 g/mol. Its IUPAC name is oxo-bis(2,2,2-trifluoroethoxy)phosphanium.
Molecular Properties
| Compound Name | oxo-bis(2,2,2-trifluoroethoxy)phosphanium |
| PubChem CID | 6386648 |
| Molecular Formula | C4H4F6O3P+ |
| Molecular Weight | 245.03 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | oxo-bis(2,2,2-trifluoroethoxy)phosphanium |
| SMILES | O=[P+](OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C4H4F6O3P/c5-3(6,7)1-12-14(11)13-2-4(8,9)10/h1-2H2/q+1 |
| InChIKey | IMDCVAFSSZPRRM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.03 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxo-bis(2,2,2-trifluoroethoxy)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo-bis(2,2,2-trifluoroethoxy)phosphanium?
The IUPAC name of oxo-bis(2,2,2-trifluoroethoxy)phosphanium (CID 6386648) is oxo-bis(2,2,2-trifluoroethoxy)phosphanium.
What is the SMILES notation for oxo-bis(2,2,2-trifluoroethoxy)phosphanium?
The canonical SMILES for oxo-bis(2,2,2-trifluoroethoxy)phosphanium is O=[P+](OCC(F)(F)F)OCC(F)(F)F.
What is the InChIKey of oxo-bis(2,2,2-trifluoroethoxy)phosphanium?
The InChIKey is IMDCVAFSSZPRRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4F6O3P/c5-3(6,7)1-12-14(11)13-2-4(8,9)10/h1-2H2/q+1.
What are the key properties of oxo-bis(2,2,2-trifluoroethoxy)phosphanium?
oxo-bis(2,2,2-trifluoroethoxy)phosphanium has a molecular weight of 245.03 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxo-bis(2,2,2-trifluoroethoxy)phosphanium is sourced from PubChem (CID 6386648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).