C13H20N4 — CID 63867772
4,6-dicyclopentyl-1,3,5-triazin-2-amine (PubChem CID 63867772) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 4,6-dicyclopentyl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dicyclopentyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63867772 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 4,6-dicyclopentyl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(C2CCCC2)nc(C2CCCC2)n1 |
| InChI | InChI=1S/C13H20N4/c14-13-16-11(9-5-1-2-6-9)15-12(17-13)10-7-3-4-8-10/h9-10H,1-8H2,(H2,14,15,16,17) |
| InChIKey | QZOOIZRPYYSDKN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |