C11H15F3N4 — CID 63867780
4-cyclohexyl-6-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine (PubChem CID 63867780) has the molecular formula C11H15F3N4 and a molecular weight of 260.26 g/mol. Its IUPAC name is 4-cyclohexyl-6-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-cyclohexyl-6-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63867780 |
| Molecular Formula | C11H15F3N4 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-cyclohexyl-6-(2,2,2-trifluoroethyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(CC(F)(F)F)nc(C2CCCCC2)n1 |
| InChI | InChI=1S/C11H15F3N4/c12-11(13,14)6-8-16-9(18-10(15)17-8)7-4-2-1-3-5-7/h7H,1-6H2,(H2,15,16,17,18) |
| InChIKey | DVZDRKCPNWDCHZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |