About N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine
N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine (PubChem CID 63867940) has the molecular formula C17H18N4
and a molecular weight of 278.36 g/mol. Its IUPAC name is N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine |
| PubChem CID | 63867940 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine |
| SMILES | CCNc1nc(-c2ccnc3ccccc23)nc(C)c1C |
| InChI | InChI=1S/C17H18N4/c1-4-18-16-11(2)12(3)20-17(21-16)14-9-10-19-15-8-6-5-7-13(14)15/h5-10H,4H2,1-3H3,(H,18,20,21) |
| InChIKey | GEJJTSNXGUHHJK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine?
The IUPAC name of N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine (CID 63867940) is N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine.
What is the SMILES notation for N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine?
The canonical SMILES for N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine is CCNc1nc(-c2ccnc3ccccc23)nc(C)c1C.
What is the InChIKey of N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine?
The InChIKey is GEJJTSNXGUHHJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4/c1-4-18-16-11(2)12(3)20-17(21-16)14-9-10-19-15-8-6-5-7-13(14)15/h5-10H,4H2,1-3H3,(H,18,20,21).
What are the key properties of N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine?
N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine has a molecular weight of 278.36 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine is sourced from PubChem (CID 63867940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).