C17H24N4 — CID 63868332
4-(3-phenylpentan-3-yl)-6-propyl-1,3,5-triazin-2-amine (PubChem CID 63868332) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-(3-phenylpentan-3-yl)-6-propyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-phenylpentan-3-yl)-6-propyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63868332 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-(3-phenylpentan-3-yl)-6-propyl-1,3,5-triazin-2-amine |
| SMILES | CCCc1nc(N)nc(C(CC)(CC)c2ccccc2)n1 |
| InChI | InChI=1S/C17H24N4/c1-4-10-14-19-15(21-16(18)20-14)17(5-2,6-3)13-11-8-7-9-12-13/h7-9,11-12H,4-6,10H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | KZADXQRLEFUGPR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |