C9H16N4 — CID 63869137
4,6-di(propan-2-yl)-1,3,5-triazin-2-amine (PubChem CID 63869137) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 4,6-di(propan-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-di(propan-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63869137 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 4,6-di(propan-2-yl)-1,3,5-triazin-2-amine |
| SMILES | CC(C)c1nc(N)nc(C(C)C)n1 |
| InChI | InChI=1S/C9H16N4/c1-5(2)7-11-8(6(3)4)13-9(10)12-7/h5-6H,1-4H3,(H2,10,11,12,13) |
| InChIKey | XFAIWPWFKJHBME-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |