C11H20N4 — CID 63869153
4,6-ditert-butyl-1,3,5-triazin-2-amine (PubChem CID 63869153) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 4,6-ditert-butyl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-ditert-butyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63869153 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 4,6-ditert-butyl-1,3,5-triazin-2-amine |
| SMILES | CC(C)(C)c1nc(N)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C11H20N4/c1-10(2,3)7-13-8(11(4,5)6)15-9(12)14-7/h1-6H3,(H2,12,13,14,15) |
| InChIKey | FERVTIDIAXRBKN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |