About N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine
N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine (PubChem CID 63869511) has the molecular formula C14H20N4OS
and a molecular weight of 292.41 g/mol. Its IUPAC name is N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine |
| PubChem CID | 63869511 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine |
| SMILES | c1nc(NCCCOC2CCNCC2)c2sccc2n1 |
| InChI | InChI=1S/C14H20N4OS/c1(8-19-11-2-6-15-7-3-11)5-16-14-13-12(4-9-20-13)17-10-18-14/h4,9-11,15H,1-3,5-8H2,(H,16,17,18) |
| InChIKey | WWBSFNXAINMGGD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine?
The IUPAC name of N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine (CID 63869511) is N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine?
The canonical SMILES for N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine is c1nc(NCCCOC2CCNCC2)c2sccc2n1.
What is the InChIKey of N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine?
The InChIKey is WWBSFNXAINMGGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4OS/c1(8-19-11-2-6-15-7-3-11)5-16-14-13-12(4-9-20-13)17-10-18-14/h4,9-11,15H,1-3,5-8H2,(H,16,17,18).
What are the key properties of N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine?
N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine has a molecular weight of 292.41 g/mol, XLogP of 2.26, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-piperidin-4-yloxypropyl)thieno[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 63869511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).