About 6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole
6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole (PubChem CID 63870572) has the molecular formula C13H15FN2O2
and a molecular weight of 250.27 g/mol. Its IUPAC name is 6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole |
| PubChem CID | 63870572 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole |
| SMILES | Fc1ccc2nc(COC3CCNCC3)oc2c1 |
| InChI | InChI=1S/C13H15FN2O2/c14-9-1-2-11-12(7-9)18-13(16-11)8-17-10-3-5-15-6-4-10/h1-2,7,10,15H,3-6,8H2 |
| InChIKey | WTVIBOPZTJDYHP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole?
The IUPAC name of 6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole (CID 63870572) is 6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole.
What is the SMILES notation for 6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole?
The canonical SMILES for 6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole is Fc1ccc2nc(COC3CCNCC3)oc2c1.
What is the InChIKey of 6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole?
The InChIKey is WTVIBOPZTJDYHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2O2/c14-9-1-2-11-12(7-9)18-13(16-11)8-17-10-3-5-15-6-4-10/h1-2,7,10,15H,3-6,8H2.
What are the key properties of 6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole?
6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole has a molecular weight of 250.27 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-(piperidin-4-yloxymethyl)-1,3-benzoxazole is sourced from PubChem (CID 63870572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).