About 2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline
2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline (PubChem CID 638710) has the molecular formula C12H11N3
and a molecular weight of 197.24 g/mol. Its IUPAC name is 2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline.
Molecular Properties
| Compound Name | 2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline |
| PubChem CID | 638710 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline |
| SMILES | Cc1nc2c(ccc3ccnc32)[nH]c1C |
| InChI | InChI=1S/C12H11N3/c1-7-8(2)15-12-10(14-7)4-3-9-5-6-13-11(9)12/h3-6,14H,1-2H3 |
| InChIKey | WTLITTGNRLXQQN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline?
The IUPAC name of 2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline (CID 638710) is 2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline.
What is the SMILES notation for 2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline?
The canonical SMILES for 2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline is Cc1nc2c(ccc3ccnc32)[nH]c1C.
What is the InChIKey of 2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline?
The InChIKey is WTLITTGNRLXQQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3/c1-7-8(2)15-12-10(14-7)4-3-9-5-6-13-11(9)12/h3-6,14H,1-2H3.
What are the key properties of 2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline?
2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline has a molecular weight of 197.24 g/mol, XLogP of 2.73, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4H-pyrrolo[2,3-f]quinoxaline is sourced from PubChem (CID 638710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).