C13H21N3O3 — CID 63871479
N-[3-(4-aminocyclohexyl)oxypropyl]-1,2-oxazole-3-carboxamide (PubChem CID 63871479) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[3-(4-aminocyclohexyl)oxypropyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-(4-aminocyclohexyl)oxypropyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 63871479 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-[3-(4-aminocyclohexyl)oxypropyl]-1,2-oxazole-3-carboxamide |
| SMILES | NC1CCC(OCCCNC(=O)c2ccon2)CC1 |
| InChI | InChI=1S/C13H21N3O3/c14-10-2-4-11(5-3-10)18-8-1-7-15-13(17)12-6-9-19-16-12/h6,9-11H,1-5,7-8,14H2,(H,15,17) |
| InChIKey | HGDOVRNPYHGZDD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|