C13H23N5O3 — CID 63871525
6-[2-(4-aminocyclohexyl)oxyethylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione (PubChem CID 63871525) has the molecular formula C13H23N5O3 and a molecular weight of 297.36 g/mol. Its IUPAC name is 6-[2-(4-aminocyclohexyl)oxyethylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[2-(4-aminocyclohexyl)oxyethylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 63871525 |
| Molecular Formula | C13H23N5O3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 6-[2-(4-aminocyclohexyl)oxyethylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione |
| SMILES | Cn1nc(NCCOC2CCC(N)CC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C13H23N5O3/c1-17-12(19)11(16-18(2)13(17)20)15-7-8-21-10-5-3-9(14)4-6-10/h9-10H,3-8,14H2,1-2H3,(H,15,16) |
| InChIKey | JDTKWDGWPIPISD-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|