C13H19N3O4S — CID 63873540
6-[(1-ethylpyrrolidin-2-yl)methylsulfamoyl]pyridine-3-carboxylic acid (PubChem CID 63873540) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 6-[(1-ethylpyrrolidin-2-yl)methylsulfamoyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[(1-ethylpyrrolidin-2-yl)methylsulfamoyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63873540 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 6-[(1-ethylpyrrolidin-2-yl)methylsulfamoyl]pyridine-3-carboxylic acid |
| SMILES | CCN1CCCC1CNS(=O)(=O)c1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C13H19N3O4S/c1-2-16-7-3-4-11(16)9-15-21(19,20)12-6-5-10(8-14-12)13(17)18/h5-6,8,11,15H,2-4,7,9H2,1H3,(H,17,18) |
| InChIKey | ZWEZQADXMZKXAI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |