C11H14O2 — CID 638736
(2R,3aS,7aS)-3-methylidene-2-prop-2-ynyl-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran (PubChem CID 638736) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (2R,3aS,7aS)-3-methylidene-2-prop-2-ynyl-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran.
| Compound Name | (2R,3aS,7aS)-3-methylidene-2-prop-2-ynyl-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran |
|---|---|
| PubChem CID | 638736 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (2R,3aS,7aS)-3-methylidene-2-prop-2-ynyl-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran |
| SMILES | C#CC[C@H]1O[C@@H]2OCCC[C@H]2C1=C |
| InChI | InChI=1S/C11H14O2/c1-3-5-10-8(2)9-6-4-7-12-11(9)13-10/h1,9-11H,2,4-7H2/t9-,10+,11-/m0/s1 |
| InChIKey | IWAPGRFMZABJSI-AXFHLTTASA-N |
| XLogP | 1.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|