C14H18N4O — CID 63873666
(3,5-dimethylpiperazin-1-yl)-(1H-indazol-3-yl)methanone (PubChem CID 63873666) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is (3,5-dimethylpiperazin-1-yl)-(1H-indazol-3-yl)methanone.
| Compound Name | (3,5-dimethylpiperazin-1-yl)-(1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 63873666 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (3,5-dimethylpiperazin-1-yl)-(1H-indazol-3-yl)methanone |
| SMILES | CC1CN(C(=O)c2n[nH]c3ccccc23)CC(C)N1 |
| InChI | InChI=1S/C14H18N4O/c1-9-7-18(8-10(2)15-9)14(19)13-11-5-3-4-6-12(11)16-17-13/h3-6,9-10,15H,7-8H2,1-2H3,(H,16,17) |
| InChIKey | HWSKXRVKKAUNBI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |