About 3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine
3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 63874430) has the molecular formula C13H18N4O2S
and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 63874430 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC1CN(S(=O)(=O)c2c[nH]c3ncccc23)CC(C)N1 |
| InChI | InChI=1S/C13H18N4O2S/c1-9-7-17(8-10(2)16-9)20(18,19)12-6-15-13-11(12)4-3-5-14-13/h3-6,9-10,16H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | QFUJJVBYCWBBSY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine (CID 63874430) is 3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine is CC1CN(S(=O)(=O)c2c[nH]c3ncccc23)CC(C)N1.
What is the InChIKey of 3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is QFUJJVBYCWBBSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O2S/c1-9-7-17(8-10(2)16-9)20(18,19)12-6-15-13-11(12)4-3-5-14-13/h3-6,9-10,16H,7-8H2,1-2H3,(H,14,15).
What are the key properties of 3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine?
3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 294.38 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 63874430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).