About 2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide
2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide (PubChem CID 63874454) has the molecular formula C13H27N3O
and a molecular weight of 241.38 g/mol. Its IUPAC name is 2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide |
| PubChem CID | 63874454 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)N1CC(C)NC(C)C1 |
| InChI | InChI=1S/C13H27N3O/c1-6-15(7-2)13(17)12(5)16-8-10(3)14-11(4)9-16/h10-12,14H,6-9H2,1-5H3 |
| InChIKey | DJPXDDGWVXIGMS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide?
The IUPAC name of 2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide (CID 63874454) is 2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide.
What is the SMILES notation for 2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide?
The canonical SMILES for 2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide is CCN(CC)C(=O)C(C)N1CC(C)NC(C)C1.
What is the InChIKey of 2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide?
The InChIKey is DJPXDDGWVXIGMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O/c1-6-15(7-2)13(17)12(5)16-8-10(3)14-11(4)9-16/h10-12,14H,6-9H2,1-5H3.
What are the key properties of 2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide?
2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide has a molecular weight of 241.38 g/mol, XLogP of 0.93, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylpiperazin-1-yl)-N,N-diethylpropanamide is sourced from PubChem (CID 63874454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).