C13H23F3N2O2 — CID 63875004
N-butyl-2-piperidin-4-yloxy-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 63875004) has the molecular formula C13H23F3N2O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-butyl-2-piperidin-4-yloxy-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-butyl-2-piperidin-4-yloxy-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 63875004 |
| Molecular Formula | C13H23F3N2O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-butyl-2-piperidin-4-yloxy-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)COC1CCNCC1 |
| InChI | InChI=1S/C13H23F3N2O2/c1-2-3-8-18(10-13(14,15)16)12(19)9-20-11-4-6-17-7-5-11/h11,17H,2-10H2,1H3 |
| InChIKey | GMNAUJIPAFWCJZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |