About 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide
3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide (PubChem CID 63875438) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide.
Molecular Properties
| Compound Name | 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide |
| PubChem CID | 63875438 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide |
| SMILES | C=CCN(CC=C)C(=O)CCOC1CCNCC1 |
| InChI | InChI=1S/C14H24N2O2/c1-3-10-16(11-4-2)14(17)7-12-18-13-5-8-15-9-6-13/h3-4,13,15H,1-2,5-12H2 |
| InChIKey | JWNGSZXCDFXYJA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide?
The IUPAC name of 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide (CID 63875438) is 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide.
What is the SMILES notation for 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide?
The canonical SMILES for 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide is C=CCN(CC=C)C(=O)CCOC1CCNCC1.
What is the InChIKey of 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide?
The InChIKey is JWNGSZXCDFXYJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O2/c1-3-10-16(11-4-2)14(17)7-12-18-13-5-8-15-9-6-13/h3-4,13,15H,1-2,5-12H2.
What are the key properties of 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide?
3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide has a molecular weight of 252.36 g/mol, XLogP of 1.35, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-4-yloxy-N,N-bis(prop-2-enyl)propanamide is sourced from PubChem (CID 63875438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).