C13H24N2O6 — CID 63876279
2-[1-[2-(2-methoxyethoxy)ethylcarbamoyl]piperidin-4-yl]oxyacetic acid (PubChem CID 63876279) has the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. Its IUPAC name is 2-[1-[2-(2-methoxyethoxy)ethylcarbamoyl]piperidin-4-yl]oxyacetic acid.
| Compound Name | 2-[1-[2-(2-methoxyethoxy)ethylcarbamoyl]piperidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 63876279 |
| Molecular Formula | C13H24N2O6 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-[1-[2-(2-methoxyethoxy)ethylcarbamoyl]piperidin-4-yl]oxyacetic acid |
| SMILES | COCCOCCNC(=O)N1CCC(OCC(=O)O)CC1 |
| InChI | InChI=1S/C13H24N2O6/c1-19-8-9-20-7-4-14-13(18)15-5-2-11(3-6-15)21-10-12(16)17/h11H,2-10H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | NFGFQUIKXJGJGX-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|