C12H20N2O6 — CID 63877473
2-[1-[(2-methoxy-2-oxoethyl)-methylcarbamoyl]piperidin-4-yl]oxyacetic acid (PubChem CID 63877473) has the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-[1-[(2-methoxy-2-oxoethyl)-methylcarbamoyl]piperidin-4-yl]oxyacetic acid.
| Compound Name | 2-[1-[(2-methoxy-2-oxoethyl)-methylcarbamoyl]piperidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 63877473 |
| Molecular Formula | C12H20N2O6 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-[1-[(2-methoxy-2-oxoethyl)-methylcarbamoyl]piperidin-4-yl]oxyacetic acid |
| SMILES | COC(=O)CN(C)C(=O)N1CCC(OCC(=O)O)CC1 |
| InChI | InChI=1S/C12H20N2O6/c1-13(7-11(17)19-2)12(18)14-5-3-9(4-6-14)20-8-10(15)16/h9H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | FRGWAYPPIRPZMR-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |