C10H16O5 — CID 638813
(3aR,4R,7aS)-4-hydroxy-7,7-dimethoxy-3,3a,4,5,6,7a-hexahydro-2-benzofuran-1-one (PubChem CID 638813) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is (3aR,4R,7aS)-4-hydroxy-7,7-dimethoxy-3,3a,4,5,6,7a-hexahydro-2-benzofuran-1-one.
| Compound Name | (3aR,4R,7aS)-4-hydroxy-7,7-dimethoxy-3,3a,4,5,6,7a-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 638813 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (3aR,4R,7aS)-4-hydroxy-7,7-dimethoxy-3,3a,4,5,6,7a-hexahydro-2-benzofuran-1-one |
| SMILES | COC1(OC)CC[C@@H](O)[C@H]2COC(=O)[C@@H]21 |
| InChI | InChI=1S/C10H16O5/c1-13-10(14-2)4-3-7(11)6-5-15-9(12)8(6)10/h6-8,11H,3-5H2,1-2H3/t6-,7-,8-/m1/s1 |
| InChIKey | UXLRYWRXBLYBKK-BWZBUEFSSA-N |
| XLogP | -0.08 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|