About 4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile
4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile (PubChem CID 63881524) has the molecular formula C15H15N3S
and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile |
| PubChem CID | 63881524 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(CNCc2cc3c(s2)CCC3)ccn1 |
| InChI | InChI=1S/C15H15N3S/c16-8-13-6-11(4-5-18-13)9-17-10-14-7-12-2-1-3-15(12)19-14/h4-7,17H,1-3,9-10H2 |
| InChIKey | IXCKSBGMLYJOHX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile?
The IUPAC name of 4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile (CID 63881524) is 4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile.
What is the SMILES notation for 4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile?
The canonical SMILES for 4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile is N#Cc1cc(CNCc2cc3c(s2)CCC3)ccn1.
What is the InChIKey of 4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile?
The InChIKey is IXCKSBGMLYJOHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3S/c16-8-13-6-11(4-5-18-13)9-17-10-14-7-12-2-1-3-15(12)19-14/h4-7,17H,1-3,9-10H2.
What are the key properties of 4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile?
4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile has a molecular weight of 269.37 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]pyridine-2-carbonitrile is sourced from PubChem (CID 63881524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).