About 4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide
4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide (PubChem CID 63882036) has the molecular formula C14H22N4
and a molecular weight of 246.36 g/mol. Its IUPAC name is 4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide.
Molecular Properties
| Compound Name | 4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide |
| PubChem CID | 63882036 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(CN2CCC(C)(C)CC2)ccn1 |
| InChI | InChI=1S/C14H22N4/c1-14(2)4-7-18(8-5-14)10-11-3-6-17-12(9-11)13(15)16/h3,6,9H,4-5,7-8,10H2,1-2H3,(H3,15,16) |
| InChIKey | OQICUTZUEUVACY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide?
The IUPAC name of 4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide (CID 63882036) is 4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide.
What is the SMILES notation for 4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide?
The canonical SMILES for 4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide is [H]/N=C(\N)c1cc(CN2CCC(C)(C)CC2)ccn1.
What is the InChIKey of 4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide?
The InChIKey is OQICUTZUEUVACY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4/c1-14(2)4-7-18(8-5-14)10-11-3-6-17-12(9-11)13(15)16/h3,6,9H,4-5,7-8,10H2,1-2H3,(H3,15,16).
What are the key properties of 4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide?
4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide has a molecular weight of 246.36 g/mol, XLogP of 1.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,4-dimethylpiperidin-1-yl)methyl]pyridine-2-carboximidamide is sourced from PubChem (CID 63882036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).