C19H19NO2 — CID 638821
1-[2-(1,3-dioxolan-2-yl)ethyl]-2-phenylindolizine (PubChem CID 638821) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-[2-(1,3-dioxolan-2-yl)ethyl]-2-phenylindolizine.
| Compound Name | 1-[2-(1,3-dioxolan-2-yl)ethyl]-2-phenylindolizine |
|---|---|
| PubChem CID | 638821 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-[2-(1,3-dioxolan-2-yl)ethyl]-2-phenylindolizine |
| SMILES | c1ccc(-c2cn3ccccc3c2CCC2OCCO2)cc1 |
| InChI | InChI=1S/C19H19NO2/c1-2-6-15(7-3-1)17-14-20-11-5-4-8-18(20)16(17)9-10-19-21-12-13-22-19/h1-8,11,14,19H,9-10,12-13H2 |
| InChIKey | DOWXBTXRDPFKFK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 22.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |