About 4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide
4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide (PubChem CID 63883468) has the molecular formula C13H16N4O2S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide.
Molecular Properties
| Compound Name | 4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide |
| PubChem CID | 63883468 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide |
| SMILES | CCC1(C)NC(=O)N(Cc2ccnc(C(N)=S)c2)C1=O |
| InChI | InChI=1S/C13H16N4O2S/c1-3-13(2)11(18)17(12(19)16-13)7-8-4-5-15-9(6-8)10(14)20/h4-6H,3,7H2,1-2H3,(H2,14,20)(H,16,19) |
| InChIKey | FPJLHKRRGNDALO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide?
The IUPAC name of 4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide (CID 63883468) is 4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide.
What is the SMILES notation for 4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide?
The canonical SMILES for 4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide is CCC1(C)NC(=O)N(Cc2ccnc(C(N)=S)c2)C1=O.
What is the InChIKey of 4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide?
The InChIKey is FPJLHKRRGNDALO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2S/c1-3-13(2)11(18)17(12(19)16-13)7-8-4-5-15-9(6-8)10(14)20/h4-6H,3,7H2,1-2H3,(H2,14,20)(H,16,19).
What are the key properties of 4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide?
4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide has a molecular weight of 292.36 g/mol, XLogP of 0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbothioamide is sourced from PubChem (CID 63883468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).