C13H11N5OS — CID 63883470
4-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]pyridine-2-carbothioamide (PubChem CID 63883470) has the molecular formula C13H11N5OS and a molecular weight of 285.33 g/mol. Its IUPAC name is 4-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]pyridine-2-carbothioamide.
| Compound Name | 4-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 63883470 |
| Molecular Formula | C13H11N5OS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-[(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]pyridine-2-carbothioamide |
| SMILES | NC(=S)c1cc(Cn2nc3ccccn3c2=O)ccn1 |
| InChI | InChI=1S/C13H11N5OS/c14-12(20)10-7-9(4-5-15-10)8-18-13(19)17-6-2-1-3-11(17)16-18/h1-7H,8H2,(H2,14,20) |
| InChIKey | IZNMSUKXHNCGJB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|