C18H14N2S — CID 63883926
2-(3,4-dimethylphenyl)sulfanylquinoline-4-carbonitrile (PubChem CID 63883926) has the molecular formula C18H14N2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)sulfanylquinoline-4-carbonitrile.
| Compound Name | 2-(3,4-dimethylphenyl)sulfanylquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 63883926 |
| Molecular Formula | C18H14N2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-(3,4-dimethylphenyl)sulfanylquinoline-4-carbonitrile |
| SMILES | Cc1ccc(Sc2cc(C#N)c3ccccc3n2)cc1C |
| InChI | InChI=1S/C18H14N2S/c1-12-7-8-15(9-13(12)2)21-18-10-14(11-19)16-5-3-4-6-17(16)20-18/h3-10H,1-2H3 |
| InChIKey | AUBUMIYEWHIUDE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |