C16H16N4S — CID 63883954
2-[methyl(thiophen-2-ylmethyl)amino]quinoline-4-carboximidamide (PubChem CID 63883954) has the molecular formula C16H16N4S and a molecular weight of 296.40 g/mol. Its IUPAC name is 2-[methyl(thiophen-2-ylmethyl)amino]quinoline-4-carboximidamide.
| Compound Name | 2-[methyl(thiophen-2-ylmethyl)amino]quinoline-4-carboximidamide |
|---|---|
| PubChem CID | 63883954 |
| Molecular Formula | C16H16N4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-[methyl(thiophen-2-ylmethyl)amino]quinoline-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(N(C)Cc2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C16H16N4S/c1-20(10-11-5-4-8-21-11)15-9-13(16(17)18)12-6-2-3-7-14(12)19-15/h2-9H,10H2,1H3,(H3,17,18) |
| InChIKey | RHGBKTVGHZISIJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|