C10H12N2S — CID 63884249
4-(propylsulfanylmethyl)pyridine-2-carbonitrile (PubChem CID 63884249) has the molecular formula C10H12N2S and a molecular weight of 192.29 g/mol. Its IUPAC name is 4-(propylsulfanylmethyl)pyridine-2-carbonitrile.
| Compound Name | 4-(propylsulfanylmethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 63884249 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 4-(propylsulfanylmethyl)pyridine-2-carbonitrile |
| SMILES | CCCSCc1ccnc(C#N)c1 |
| InChI | InChI=1S/C10H12N2S/c1-2-5-13-8-9-3-4-12-10(6-9)7-11/h3-4,6H,2,5,8H2,1H3 |
| InChIKey | ORRSZKVTUYUDCA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|