C8H9NO2S — CID 63884403
4-(methylsulfanylmethyl)pyridine-2-carboxylic acid (PubChem CID 63884403) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is 4-(methylsulfanylmethyl)pyridine-2-carboxylic acid.
| Compound Name | 4-(methylsulfanylmethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 63884403 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | 4-(methylsulfanylmethyl)pyridine-2-carboxylic acid |
| SMILES | CSCc1ccnc(C(=O)O)c1 |
| InChI | InChI=1S/C8H9NO2S/c1-12-5-6-2-3-9-7(4-6)8(10)11/h2-4H,5H2,1H3,(H,10,11) |
| InChIKey | ZMOSDLOEPXSYSJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |