About 2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile
2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile (PubChem CID 63885038) has the molecular formula C18H21N3
and a molecular weight of 279.39 g/mol. Its IUPAC name is 2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile |
| PubChem CID | 63885038 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile |
| SMILES | CC1CCCC(Nc2cc(C#N)c3ccccc3n2)C1C |
| InChI | InChI=1S/C18H21N3/c1-12-6-5-9-16(13(12)2)20-18-10-14(11-19)15-7-3-4-8-17(15)21-18/h3-4,7-8,10,12-13,16H,5-6,9H2,1-2H3,(H,20,21) |
| InChIKey | KNEFTJMDVXIKES-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile?
The IUPAC name of 2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile (CID 63885038) is 2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile.
What is the SMILES notation for 2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile?
The canonical SMILES for 2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile is CC1CCCC(Nc2cc(C#N)c3ccccc3n2)C1C.
What is the InChIKey of 2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile?
The InChIKey is KNEFTJMDVXIKES-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3/c1-12-6-5-9-16(13(12)2)20-18-10-14(11-19)15-7-3-4-8-17(15)21-18/h3-4,7-8,10,12-13,16H,5-6,9H2,1-2H3,(H,20,21).
What are the key properties of 2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile?
2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile has a molecular weight of 279.39 g/mol, XLogP of 4.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-dimethylcyclohexyl)amino]quinoline-4-carbonitrile is sourced from PubChem (CID 63885038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).