C16H15NO3 — CID 638855
(1R,2S,11S,14R,15S)-12-oxa-3-azapentacyclo[13.2.1.02,14.03,11.05,10]octadeca-5,7,9-triene-4,13-dione (PubChem CID 638855) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is (1R,2S,11S,14R,15S)-12-oxa-3-azapentacyclo[13.2.1.02,14.03,11.05,10]octadeca-5,7,9-triene-4,13-dione.
| Compound Name | (1R,2S,11S,14R,15S)-12-oxa-3-azapentacyclo[13.2.1.02,14.03,11.05,10]octadeca-5,7,9-triene-4,13-dione |
|---|---|
| PubChem CID | 638855 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (1R,2S,11S,14R,15S)-12-oxa-3-azapentacyclo[13.2.1.02,14.03,11.05,10]octadeca-5,7,9-triene-4,13-dione |
| SMILES | O=C1O[C@H]2c3ccccc3C(=O)N2[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]12 |
| InChI | InChI=1S/C16H15NO3/c18-14-10-3-1-2-4-11(10)15-17(14)13-9-6-5-8(7-9)12(13)16(19)20-15/h1-4,8-9,12-13,15H,5-7H2/t8-,9+,12+,13-,15-/m0/s1 |
| InChIKey | ZABNSYLERNHBAW-LLSOINDXSA-N |
| XLogP | 2.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |