C16H19N3 — CID 63886594
2-(hexan-2-ylamino)quinoline-4-carbonitrile (PubChem CID 63886594) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-(hexan-2-ylamino)quinoline-4-carbonitrile.
| Compound Name | 2-(hexan-2-ylamino)quinoline-4-carbonitrile |
|---|---|
| PubChem CID | 63886594 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-(hexan-2-ylamino)quinoline-4-carbonitrile |
| SMILES | CCCCC(C)Nc1cc(C#N)c2ccccc2n1 |
| InChI | InChI=1S/C16H19N3/c1-3-4-7-12(2)18-16-10-13(11-17)14-8-5-6-9-15(14)19-16/h5-6,8-10,12H,3-4,7H2,1-2H3,(H,18,19) |
| InChIKey | HCDXSJDEZAADEV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |