C17H28N4 — CID 63887071
[4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]-2-pyridinyl]methanamine (PubChem CID 63887071) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is [4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]-2-pyridinyl]methanamine.
| Compound Name | [4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 63887071 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | [4-[(4-piperidin-1-ylpiperidin-1-yl)methyl]-2-pyridinyl]methanamine |
| SMILES | NCc1cc(CN2CCC(N3CCCCC3)CC2)ccn1 |
| InChI | InChI=1S/C17H28N4/c18-13-16-12-15(4-7-19-16)14-20-10-5-17(6-11-20)21-8-2-1-3-9-21/h4,7,12,17H,1-3,5-6,8-11,13-14,18H2 |
| InChIKey | WYZHBQVYJGEFTN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |