C21H26O3 — CID 638873
(1E,4E,6S,8E)-1,11-bis(furan-3-yl)-4,8-dimethylundeca-1,4,8-trien-6-ol (PubChem CID 638873) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (1E,4E,6S,8E)-1,11-bis(furan-3-yl)-4,8-dimethylundeca-1,4,8-trien-6-ol.
| Compound Name | (1E,4E,6S,8E)-1,11-bis(furan-3-yl)-4,8-dimethylundeca-1,4,8-trien-6-ol |
|---|---|
| PubChem CID | 638873 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (1E,4E,6S,8E)-1,11-bis(furan-3-yl)-4,8-dimethylundeca-1,4,8-trien-6-ol |
| SMILES | C/C(=C\[C@@H](O)C/C(C)=C/CCc1ccoc1)C/C=C/c1ccoc1 |
| InChI | InChI=1S/C21H26O3/c1-17(5-3-7-19-9-11-23-15-19)13-21(22)14-18(2)6-4-8-20-10-12-24-16-20/h3,6-7,9-13,15-16,21-22H,4-5,8,14H2,1-2H3/b7-3+,17-13+,18-6+/t21-/m1/s1 |
| InChIKey | SIXUXMXDQFOIKA-DXHCCZSWSA-N |
| XLogP | 5.55 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|