C13H21N3 — CID 63887449
N-[[2-(aminomethyl)-4-pyridinyl]methyl]-N-propylcyclopropanamine (PubChem CID 63887449) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N-[[2-(aminomethyl)-4-pyridinyl]methyl]-N-propylcyclopropanamine.
| Compound Name | N-[[2-(aminomethyl)-4-pyridinyl]methyl]-N-propylcyclopropanamine |
|---|---|
| PubChem CID | 63887449 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-[[2-(aminomethyl)-4-pyridinyl]methyl]-N-propylcyclopropanamine |
| SMILES | CCCN(Cc1ccnc(CN)c1)C1CC1 |
| InChI | InChI=1S/C13H21N3/c1-2-7-16(13-3-4-13)10-11-5-6-15-12(8-11)9-14/h5-6,8,13H,2-4,7,9-10,14H2,1H3 |
| InChIKey | ZMJZSMWXSBTTSD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |