C13H9Br2N3O — CID 63889415
4-[(4-amino-2,6-dibromophenoxy)methyl]pyridine-2-carbonitrile (PubChem CID 63889415) has the molecular formula C13H9Br2N3O and a molecular weight of 383.04 g/mol. Its IUPAC name is 4-[(4-amino-2,6-dibromophenoxy)methyl]pyridine-2-carbonitrile.
| Compound Name | 4-[(4-amino-2,6-dibromophenoxy)methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 63889415 |
| Molecular Formula | C13H9Br2N3O |
| Molecular Weight | 383.04 g/mol |
| Exact Mass | 380.91 |
| IUPAC Name | 4-[(4-amino-2,6-dibromophenoxy)methyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(COc2c(Br)cc(N)cc2Br)ccn1 |
| InChI | InChI=1S/C13H9Br2N3O/c14-11-4-9(17)5-12(15)13(11)19-7-8-1-2-18-10(3-8)6-16/h1-5H,7,17H2 |
| InChIKey | OOHQKZDPSOZZJK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.04 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|