C15H21BrN2O2 — CID 63890091
4-[4-bromo-2-[(cyclopropylamino)methyl]phenoxy]-N-methylbutanamide (PubChem CID 63890091) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 4-[4-bromo-2-[(cyclopropylamino)methyl]phenoxy]-N-methylbutanamide.
| Compound Name | 4-[4-bromo-2-[(cyclopropylamino)methyl]phenoxy]-N-methylbutanamide |
|---|---|
| PubChem CID | 63890091 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 4-[4-bromo-2-[(cyclopropylamino)methyl]phenoxy]-N-methylbutanamide |
| SMILES | CNC(=O)CCCOc1ccc(Br)cc1CNC1CC1 |
| InChI | InChI=1S/C15H21BrN2O2/c1-17-15(19)3-2-8-20-14-7-4-12(16)9-11(14)10-18-13-5-6-13/h4,7,9,13,18H,2-3,5-6,8,10H2,1H3,(H,17,19) |
| InChIKey | DMVBNWKSNXJLNR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|