C16H18N2O5 — CID 6389169
(3Z)-3-(furan-2-carbonylhydrazinylidene)-4,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 6389169) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is (3Z)-3-(furan-2-carbonylhydrazinylidene)-4,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid.
| Compound Name | (3Z)-3-(furan-2-carbonylhydrazinylidene)-4,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 6389169 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (3Z)-3-(furan-2-carbonylhydrazinylidene)-4,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | CC12CCC(C(=O)O)(C(=O)/C1=N\NC(=O)c1ccco1)C2(C)C |
| InChI | InChI=1S/C16H18N2O5/c1-14(2)15(3)6-7-16(14,13(21)22)11(19)10(15)17-18-12(20)9-5-4-8-23-9/h4-5,8H,6-7H2,1-3H3,(H,18,20)(H,21,22)/b17-10+ |
| InChIKey | UAWRAYLZHPCOCO-LICLKQGHSA-N |
| XLogP | 1.85 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|