C13H13ClO2S — CID 638917
methyl 2-(4-chlorophenyl)sulfanyl-4-methylpenta-2,3-dienoate (PubChem CID 638917) has the molecular formula C13H13ClO2S and a molecular weight of 268.76 g/mol. Its IUPAC name is methyl 2-(4-chlorophenyl)sulfanyl-4-methylpenta-2,3-dienoate.
| Compound Name | methyl 2-(4-chlorophenyl)sulfanyl-4-methylpenta-2,3-dienoate |
|---|---|
| PubChem CID | 638917 |
| Molecular Formula | C13H13ClO2S |
| Molecular Weight | 268.76 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | methyl 2-(4-chlorophenyl)sulfanyl-4-methylpenta-2,3-dienoate |
| SMILES | COC(=O)C(=C=C(C)C)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H13ClO2S/c1-9(2)8-12(13(15)16-3)17-11-6-4-10(14)5-7-11/h4-7H,1-3H3 |
| InChIKey | PCVPSYMKLDBOCT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.76 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|