C20H30BrSi — CID 6389189
Silane, bromobis(1,2,3,4,5-pentamethyl-2,4-cyclopentadien-1-yl)- (PubChem CID 6389189) has the molecular formula C20H30BrSi and a molecular weight of 378.45 g/mol.
| Compound Name | Silane, bromobis(1,2,3,4,5-pentamethyl-2,4-cyclopentadien-1-yl)- |
|---|---|
| PubChem CID | 6389189 |
| Molecular Formula | C20H30BrSi |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | — |
| SMILES | CC1=C(C)C(C)([Si](Br)C2(C)C(C)=C(C)C(C)=C2C)C(C)=C1C |
| InChI | InChI=1S/C20H30BrSi/c1-11-12(2)16(6)19(9,15(11)5)22(21)20(10)17(7)13(3)14(4)18(20)8/h1-10H3 |
| InChIKey | VATMWEFIYBULMW-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|