About 4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide
4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide (PubChem CID 63891899) has the molecular formula C8H15N5O
and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide.
Molecular Properties
| Compound Name | 4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide |
| PubChem CID | 63891899 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide |
| SMILES | CNC(=O)CCCn1cnc(CN)n1 |
| InChI | InChI=1S/C8H15N5O/c1-10-8(14)3-2-4-13-6-11-7(5-9)12-13/h6H,2-5,9H2,1H3,(H,10,14) |
| InChIKey | LPXAWIBAWISDBE-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide?
The IUPAC name of 4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide (CID 63891899) is 4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide.
What is the SMILES notation for 4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide?
The canonical SMILES for 4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide is CNC(=O)CCCn1cnc(CN)n1.
What is the InChIKey of 4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide?
The InChIKey is LPXAWIBAWISDBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N5O/c1-10-8(14)3-2-4-13-6-11-7(5-9)12-13/h6H,2-5,9H2,1H3,(H,10,14).
What are the key properties of 4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide?
4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide has a molecular weight of 197.24 g/mol, XLogP of -0.74, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(aminomethyl)-1,2,4-triazol-1-yl]-N-methylbutanamide is sourced from PubChem (CID 63891899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).