C13H17N3 — CID 6389249
2,6-bis(3,4-dihydro-2H-pyrrol-5-yl)-1,2-dihydropyridine (PubChem CID 6389249) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2,6-bis(3,4-dihydro-2H-pyrrol-5-yl)-1,2-dihydropyridine.
| Compound Name | 2,6-bis(3,4-dihydro-2H-pyrrol-5-yl)-1,2-dihydropyridine |
|---|---|
| PubChem CID | 6389249 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2,6-bis(3,4-dihydro-2H-pyrrol-5-yl)-1,2-dihydropyridine |
| SMILES | C1=CC(C2=NCCC2)NC(C2=NCCC2)=C1 |
| InChI | InChI=1S/C13H17N3/c1-4-12(10-6-2-8-14-10)16-13(5-1)11-7-3-9-15-11/h1,4-5,12,16H,2-3,6-9H2 |
| InChIKey | NGTQBMGWPWVLPC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |