About bis(4-amino-1H-pyrimidin-2-one);dichlorocopper
bis(4-amino-1H-pyrimidin-2-one);dichlorocopper (PubChem CID 6389315) has the molecular formula C8H10Cl2CuN6O2
and a molecular weight of 356.66 g/mol. Its IUPAC name is bis(4-amino-1H-pyrimidin-2-one);dichlorocopper.
Molecular Properties
| Compound Name | bis(4-amino-1H-pyrimidin-2-one);dichlorocopper |
| PubChem CID | 6389315 |
| Molecular Formula | C8H10Cl2CuN6O2 |
| Molecular Weight | 356.66 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | bis(4-amino-1H-pyrimidin-2-one);dichlorocopper |
| SMILES | Cl[Cu]Cl.Nc1cc[nH]c(=O)n1.Nc1cc[nH]c(=O)n1 |
| InChI | InChI=1S/2C4H5N3O.2ClH.Cu/c2*5-3-1-2-6-4(8)7-3;;;/h2*1-2H,(H3,5,6,7,8);2*1H;/q;;;;+2/p-2 |
| InChIKey | YANOSERQOICLCQ-UHFFFAOYSA-L |
| XLogP | 0.08 |
| TPSA | 143.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.66 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(4-amino-1H-pyrimidin-2-one);dichlorocopper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-amino-1H-pyrimidin-2-one);dichlorocopper?
The IUPAC name of bis(4-amino-1H-pyrimidin-2-one);dichlorocopper (CID 6389315) is bis(4-amino-1H-pyrimidin-2-one);dichlorocopper.
What is the SMILES notation for bis(4-amino-1H-pyrimidin-2-one);dichlorocopper?
The canonical SMILES for bis(4-amino-1H-pyrimidin-2-one);dichlorocopper is Cl[Cu]Cl.Nc1cc[nH]c(=O)n1.Nc1cc[nH]c(=O)n1.
What is the InChIKey of bis(4-amino-1H-pyrimidin-2-one);dichlorocopper?
The InChIKey is YANOSERQOICLCQ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H5N3O.2ClH.Cu/c2*5-3-1-2-6-4(8)7-3;;;/h2*1-2H,(H3,5,6,7,8);2*1H;/q;;;;+2/p-2.
What are the key properties of bis(4-amino-1H-pyrimidin-2-one);dichlorocopper?
bis(4-amino-1H-pyrimidin-2-one);dichlorocopper has a molecular weight of 356.66 g/mol, XLogP of 0.08, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-amino-1H-pyrimidin-2-one);dichlorocopper is sourced from PubChem (CID 6389315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).