About [4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate
[4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate (PubChem CID 6389384) has the molecular formula C15H15NO4
and a molecular weight of 273.29 g/mol. Its IUPAC name is [4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate.
Molecular Properties
| Compound Name | [4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate |
| PubChem CID | 6389384 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | [4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate |
| SMILES | CC/C=C1/CC(=O)N(c2ccc(OC(C)=O)cc2)C1=O |
| InChI | InChI=1S/C15H15NO4/c1-3-4-11-9-14(18)16(15(11)19)12-5-7-13(8-6-12)20-10(2)17/h4-8H,3,9H2,1-2H3/b11-4- |
| InChIKey | BATKZCCFTDZYTF-WCIBSUBMSA-N |
| XLogP | 2.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate?
The IUPAC name of [4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate (CID 6389384) is [4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate.
What is the SMILES notation for [4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate?
The canonical SMILES for [4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate is CC/C=C1/CC(=O)N(c2ccc(OC(C)=O)cc2)C1=O.
What is the InChIKey of [4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate?
The InChIKey is BATKZCCFTDZYTF-WCIBSUBMSA-N. The full InChI is InChI=1S/C15H15NO4/c1-3-4-11-9-14(18)16(15(11)19)12-5-7-13(8-6-12)20-10(2)17/h4-8H,3,9H2,1-2H3/b11-4-.
What are the key properties of [4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate?
[4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate has a molecular weight of 273.29 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3Z)-2,5-dioxo-3-propylidenepyrrolidin-1-yl]phenyl] acetate is sourced from PubChem (CID 6389384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).