C18H17NO — CID 63894530
(2,3-dimethylphenyl)-isoquinolin-5-ylmethanol (PubChem CID 63894530) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-isoquinolin-5-ylmethanol.
| Compound Name | (2,3-dimethylphenyl)-isoquinolin-5-ylmethanol |
|---|---|
| PubChem CID | 63894530 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (2,3-dimethylphenyl)-isoquinolin-5-ylmethanol |
| SMILES | Cc1cccc(C(O)c2cccc3cnccc23)c1C |
| InChI | InChI=1S/C18H17NO/c1-12-5-3-7-15(13(12)2)18(20)17-8-4-6-14-11-19-10-9-16(14)17/h3-11,18,20H,1-2H3 |
| InChIKey | LICPFSRRQAUDHJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |