C12H7Br2F3O2 — CID 63894639
(4,5-dibromofuran-2-yl)-[2-(trifluoromethyl)phenyl]methanol (PubChem CID 63894639) has the molecular formula C12H7Br2F3O2 and a molecular weight of 399.99 g/mol. Its IUPAC name is (4,5-dibromofuran-2-yl)-[2-(trifluoromethyl)phenyl]methanol.
| Compound Name | (4,5-dibromofuran-2-yl)-[2-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 63894639 |
| Molecular Formula | C12H7Br2F3O2 |
| Molecular Weight | 399.99 g/mol |
| Exact Mass | 397.88 |
| IUPAC Name | (4,5-dibromofuran-2-yl)-[2-(trifluoromethyl)phenyl]methanol |
| SMILES | OC(c1cc(Br)c(Br)o1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H7Br2F3O2/c13-8-5-9(19-11(8)14)10(18)6-3-1-2-4-7(6)12(15,16)17/h1-5,10,18H |
| InChIKey | UNPZZBPVDMPSNK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.99 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |