C16H16Br2O3 — CID 63895550
1,2-bis(5-bromo-2-methoxyphenyl)ethanol (PubChem CID 63895550) has the molecular formula C16H16Br2O3 and a molecular weight of 416.11 g/mol. Its IUPAC name is 1,2-bis(5-bromo-2-methoxyphenyl)ethanol.
| Compound Name | 1,2-bis(5-bromo-2-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 63895550 |
| Molecular Formula | C16H16Br2O3 |
| Molecular Weight | 416.11 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | 1,2-bis(5-bromo-2-methoxyphenyl)ethanol |
| SMILES | COc1ccc(Br)cc1CC(O)c1cc(Br)ccc1OC |
| InChI | InChI=1S/C16H16Br2O3/c1-20-15-5-3-11(17)7-10(15)8-14(19)13-9-12(18)4-6-16(13)21-2/h3-7,9,14,19H,8H2,1-2H3 |
| InChIKey | WVQFPUPFFFFXIG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.11 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |