About cyclopentyl-(4,5-dibromofuran-2-yl)methanol
cyclopentyl-(4,5-dibromofuran-2-yl)methanol (PubChem CID 63895593) has the molecular formula C10H12Br2O2
and a molecular weight of 324.01 g/mol. Its IUPAC name is cyclopentyl-(4,5-dibromofuran-2-yl)methanol.
Molecular Properties
| Compound Name | cyclopentyl-(4,5-dibromofuran-2-yl)methanol |
| PubChem CID | 63895593 |
| Molecular Formula | C10H12Br2O2 |
| Molecular Weight | 324.01 g/mol |
| Exact Mass | 321.92 |
| IUPAC Name | cyclopentyl-(4,5-dibromofuran-2-yl)methanol |
| SMILES | OC(c1cc(Br)c(Br)o1)C1CCCC1 |
| InChI | InChI=1S/C10H12Br2O2/c11-7-5-8(14-10(7)12)9(13)6-3-1-2-4-6/h5-6,9,13H,1-4H2 |
| InChIKey | GXKQGJWWUICEMP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.01 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopentyl-(4,5-dibromofuran-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl-(4,5-dibromofuran-2-yl)methanol?
The IUPAC name of cyclopentyl-(4,5-dibromofuran-2-yl)methanol (CID 63895593) is cyclopentyl-(4,5-dibromofuran-2-yl)methanol.
What is the SMILES notation for cyclopentyl-(4,5-dibromofuran-2-yl)methanol?
The canonical SMILES for cyclopentyl-(4,5-dibromofuran-2-yl)methanol is OC(c1cc(Br)c(Br)o1)C1CCCC1.
What is the InChIKey of cyclopentyl-(4,5-dibromofuran-2-yl)methanol?
The InChIKey is GXKQGJWWUICEMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Br2O2/c11-7-5-8(14-10(7)12)9(13)6-3-1-2-4-6/h5-6,9,13H,1-4H2.
What are the key properties of cyclopentyl-(4,5-dibromofuran-2-yl)methanol?
cyclopentyl-(4,5-dibromofuran-2-yl)methanol has a molecular weight of 324.01 g/mol, XLogP of 4.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl-(4,5-dibromofuran-2-yl)methanol is sourced from PubChem (CID 63895593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).